CAS 138530-95-7 appears in our catalog under these names: (S)-Lansoprazole, >95% (HPLC), (S)-Lansoprazole, Levolansoprazole/ 98.62% (existing batch purity), (S)–Lansoprazole, (S)-Lansoprazole 99%. Offered by: TRC, Chemat Brand, TargetMol, GLPBio, Biosynth. Available pack sizes: 1mg, 5mg, on request, 2mg, 10mg, 25mg, 50mg, 100mg.
2-[(S)-[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylsulfinyl]-1H-benzimidazole (CAS 138530-95-7) is a chemical compound with the molecular formula C16H14F3N3O2S and a molecular weight of 369.4 g/mol. IUPAC name: 2-[(S)-[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylsulfinyl]-1H-benzimidazole. InChIKey: MJIHNNLFOKEZEW-VWLOTQADSA-N.
| Molecular formula | C16H14F3N3O2S |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | 2-[(S)-[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylsulfinyl]-1H-benzimidazole |
| InChIKey | MJIHNNLFOKEZEW-VWLOTQADSA-N |
| SMILES | CC1=C(C=CN=C1C[S@](=O)C2=NC3=CC=CC=C3N2)OCC(F)(F)F |
Computed by PubChem (NCBI)