CAS 934294-22-1 appears in our catalog under these names: Lansoprazole–d4, Lansoprazole-d4, Lansoprazole-d4, >95% (HPLC), Lansoprazole-d4 (benzimidazole-4,5,6,7-d4), 98 atom % D, min 98% Chemical Purity, Lansoprazole-d4, 99.82%. Offered by: GLPBio, Chemat Brand, TRC, CDN, TargetMol. Available pack sizes: 1mg, on request, 2,5mg, 25mg, 5mg, 0,01g, 0,005g, 10mg.
4,5,6,7-tetradeuterio-2-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylsulfinyl]-1H-benzimidazole (CAS 934294-22-1) is a chemical compound with the molecular formula C16H14F3N3O2S and a molecular weight of 373.4 g/mol. IUPAC name: 4,5,6,7-tetradeuterio-2-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylsulfinyl]-1H-benzimidazole. InChIKey: MJIHNNLFOKEZEW-QFFDRWTDSA-N.
| Molecular formula | C16H14F3N3O2S |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | 4,5,6,7-tetradeuterio-2-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylsulfinyl]-1H-benzimidazole |
| InChIKey | MJIHNNLFOKEZEW-QFFDRWTDSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])NC(=N2)S(=O)CC3=NC=CC(=C3C)OCC(F)(F)F)[2H])[2H] |
Computed by PubChem (NCBI)