CAS 28401-75-4 appears in our catalog under these names: L-Glutamic acid gamma-(alpha-naphthylamide), 95%, H–Glu(αNA)–OH. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 100mg, 5g, 1g.
(2S)-2-amino-5-(naphthalen-1-ylamino)-5-oxopentanoic acid (CAS 28401-75-4) is a chemical compound with the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. IUPAC name: (2S)-2-amino-5-(naphthalen-1-ylamino)-5-oxopentanoic acid. InChIKey: QOGFVABMAJFJDJ-LBPRGKRZSA-N.
| Molecular formula | C15H16N2O3 |
|---|---|
| Molecular weight | 272.30 g/mol |
| IUPAC name | (2S)-2-amino-5-(naphthalen-1-ylamino)-5-oxopentanoic acid |
| InChIKey | QOGFVABMAJFJDJ-LBPRGKRZSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2NC(=O)CC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)