Products 13861-71-7
CAS 13861-71-7 is the registry number for Securitinine. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 10mg, 50mg, 1 mg, 5 mg.
(1S,2S,4S,8S)-4-methoxy-14-oxa-7-azatetracyclo[6.6.1.01,11.02,7]pentadeca-9,11-dien-13-one (CAS 13861-71-7) is a chemical compound with the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. IUPAC name: (1S,2S,4S,8S)-4-methoxy-14-oxa-7-azatetracyclo[6.6.1.01,11.02,7]pentadeca-9,11-dien-13-one. InChIKey: YKLWRYOORWTCQQ-UHXUPSOCSA-N.
| Molecular formula | C14H17NO3 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | (1S,2S,4S,8S)-4-methoxy-14-oxa-7-azatetracyclo[6.6.1.01,11.02,7]pentadeca-9,11-dien-13-one |
| InChIKey | YKLWRYOORWTCQQ-UHXUPSOCSA-N |
| SMILES | CO[C@H]1CCN2[C@@H](C1)[C@]34C[C@H]2C=CC3=CC(=O)O4 |
Computed by PubChem (NCBI)
Synonyms:
Securitinine, orb1681717