CAS 138624-58-5 is the registry number for 4-Phenyl-4H-1,2,4-triazole-3-carbaldehyde. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-phenyl-1,2,4-triazole-3-carbaldehyde (CAS 138624-58-5) is a chemical compound with the molecular formula C9H7N3O and a molecular weight of 173.17 g/mol. IUPAC name: 4-phenyl-1,2,4-triazole-3-carbaldehyde. InChIKey: QKXBTXPBQRIDNF-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | 4-phenyl-1,2,4-triazole-3-carbaldehyde |
| InChIKey | QKXBTXPBQRIDNF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=NN=C2C=O |
Computed by PubChem (NCBI)