CAS 138642-93-0 appears in our catalog under these names: 3-Cyano-4-methylbenzoic acid, 96%, 3-Cyano-4-methylbenzoic acid, 3-Cyano-4-methylbenzoic acid 97%, 3-Cyano-4-methylbenzoic acid, 97%, 97%, 3-cyano-4-methylbenzoic acid, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg.
3-cyano-4-methylbenzoic acid (CAS 138642-93-0) is a chemical compound with the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. IUPAC name: 3-cyano-4-methylbenzoic acid. InChIKey: GWSXYSZAGOCSNP-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2 |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 3-cyano-4-methylbenzoic acid |
| InChIKey | GWSXYSZAGOCSNP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)O)C#N |
Computed by PubChem (NCBI)