CAS 138662-60-9 appears in our catalog under these names: Relebactam Impurity 14, (2R, 5S)-5-Hydroxy-Pipecolic Acid. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,5S)-5-hydroxypiperidine-2-carboxylic acid (CAS 138662-60-9) is a chemical compound with the molecular formula C6H11NO3 and a molecular weight of 145.16 g/mol. IUPAC name: (2R,5S)-5-hydroxypiperidine-2-carboxylic acid. InChIKey: RKEYKDXXZCICFZ-CRCLSJGQSA-N.
| Molecular formula | C6H11NO3 |
|---|---|
| Molecular weight | 145.16 g/mol |
| IUPAC name | (2R,5S)-5-hydroxypiperidine-2-carboxylic acid |
| InChIKey | RKEYKDXXZCICFZ-CRCLSJGQSA-N |
| SMILES | C1C[C@@H](NC[C@H]1O)C(=O)O |
Computed by PubChem (NCBI)