Products 448964-01-0

CAS 448964-01-0 is the registry number for Relebactam Impurity 13. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2R,5R)-5-hydroxypiperidine-2-carboxylic acid (CAS 448964-01-0) is a chemical compound with the molecular formula C6H11NO3 and a molecular weight of 145.16 g/mol. IUPAC name: (2R,5R)-5-hydroxypiperidine-2-carboxylic acid. InChIKey: RKEYKDXXZCICFZ-RFZPGFLSSA-N.

Identity
Molecular formulaC6H11NO3
Molecular weight145.16 g/mol
IUPAC name(2R,5R)-5-hydroxypiperidine-2-carboxylic acid
InChIKeyRKEYKDXXZCICFZ-RFZPGFLSSA-N
SMILESC1C[C@@H](NC[C@@H]1O)C(=O)O

Computed by PubChem (NCBI)