Products 2227384-17-8
CAS 2227384-17-8 is the registry number for Icalcaprant. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[4-[[(2S)-2-(3-methoxy-1-methylpyrazol-4-yl)pyrrolidin-1-yl]methyl]phenoxy]benzamide (CAS 2227384-17-8) is a chemical compound with the molecular formula C23H26N4O3 and a molecular weight of 406.5 g/mol. IUPAC name: 4-[4-[[(2S)-2-(3-methoxy-1-methylpyrazol-4-yl)pyrrolidin-1-yl]methyl]phenoxy]benzamide. InChIKey: OBDLEFCGVHQDFR-NRFANRHFSA-N.
| Molecular formula | C23H26N4O3 |
|---|---|
| Molecular weight | 406.5 g/mol |
| IUPAC name | 4-[4-[[(2S)-2-(3-methoxy-1-methylpyrazol-4-yl)pyrrolidin-1-yl]methyl]phenoxy]benzamide |
| InChIKey | OBDLEFCGVHQDFR-NRFANRHFSA-N |
| SMILES | CN1C=C(C(=N1)OC)[C@@H]2CCCN2CC3=CC=C(C=C3)OC4=CC=C(C=C4)C(=O)N |
Computed by PubChem (NCBI)