CAS 1386948-25-9 is the registry number for 3,4-Dihydroxybenzaldehyde-formyl-13C. Offered by: TRC. Available pack sizes: 25mg.
3,4-dihydroxy(13C)benzaldehyde (CAS 1386948-25-9) is a chemical compound with the molecular formula C7H6O3 and a molecular weight of 139.11 g/mol. IUPAC name: 3,4-dihydroxy(13C)benzaldehyde. InChIKey: IBGBGRVKPALMCQ-AZXPZELESA-N.
| Molecular formula | C7H6O3 |
|---|---|
| Molecular weight | 139.11 g/mol |
| IUPAC name | 3,4-dihydroxy(13C)benzaldehyde |
| InChIKey | IBGBGRVKPALMCQ-AZXPZELESA-N |
| SMILES | C1=CC(=C(C=C1[13CH]=O)O)O |
Computed by PubChem (NCBI)