CAS 180028-20-0 is the registry number for 3,4-Dihydroxybenzaldehyde-d3. Offered by: TRC. Available pack sizes: 10mg, 50mg.
2,3,6-trideuterio-4,5-dihydroxybenzaldehyde (CAS 180028-20-0) is a chemical compound with the molecular formula C7H6O3 and a molecular weight of 141.14 g/mol. IUPAC name: 2,3,6-trideuterio-4,5-dihydroxybenzaldehyde. InChIKey: IBGBGRVKPALMCQ-CBYSEHNBSA-N.
| Molecular formula | C7H6O3 |
|---|---|
| Molecular weight | 141.14 g/mol |
| IUPAC name | 2,3,6-trideuterio-4,5-dihydroxybenzaldehyde |
| InChIKey | IBGBGRVKPALMCQ-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C=O)[2H])O)O)[2H] |
Computed by PubChem (NCBI)