Products 138711-55-4
CAS 138711-55-4 is the registry number for Monbarbatain A. Offered by: MedChemExpress. Available pack sizes: 1 mg, 10 mg, 5 mg.
8-(4,7-dihydroxy-2-methoxyphenanthren-1-yl)-7-methoxyphenanthrene-2,5-diol (CAS 138711-55-4) is a chemical compound with the molecular formula C30H22O6 and a molecular weight of 478.5 g/mol. IUPAC name: 8-(4,7-dihydroxy-2-methoxyphenanthren-1-yl)-7-methoxyphenanthrene-2,5-diol. InChIKey: RBVCTUJCRSUBKB-UHFFFAOYSA-N.
| Molecular formula | C30H22O6 |
|---|---|
| Molecular weight | 478.5 g/mol |
| IUPAC name | 8-(4,7-dihydroxy-2-methoxyphenanthren-1-yl)-7-methoxyphenanthrene-2,5-diol |
| InChIKey | RBVCTUJCRSUBKB-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C3=C(C=C2)C=C(C=C3)O)C(=C1)O)C4=C(C=C(C5=C4C=CC6=C5C=CC(=C6)O)O)OC |
Computed by PubChem (NCBI)