Products 1444490-70-3
CAS 1444490-70-3 is the registry number for 2-((4-Benzoylbenzoyl)oxy)ethyl 3-benzoylbenzoate, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
2-(4-benzoylbenzoyl)oxyethyl 3-benzoylbenzoate (CAS 1444490-70-3) is a chemical compound with the molecular formula C30H22O6 and a molecular weight of 478.5 g/mol. IUPAC name: 2-(4-benzoylbenzoyl)oxyethyl 3-benzoylbenzoate. InChIKey: ZMTSDFCHKHBEHO-UHFFFAOYSA-N.
| Molecular formula | C30H22O6 |
|---|---|
| Molecular weight | 478.5 g/mol |
| IUPAC name | 2-(4-benzoylbenzoyl)oxyethyl 3-benzoylbenzoate |
| InChIKey | ZMTSDFCHKHBEHO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)C(=O)OCCOC(=O)C3=CC=CC(=C3)C(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)