Products 1388021-03-1
CAS 1388021-03-1 appears in our catalog under these names: 5-Fluorobenzofuran-7-carboxylic acid, 5-Fluorobenzofuran-7-carboxylic acid, 95%, 95%, 5-Fluorobenzofuran-7-carboxylic acid, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg.
5-fluoro-1-benzofuran-7-carboxylic acid (CAS 1388021-03-1) is a chemical compound with the molecular formula C9H5FO3 and a molecular weight of 180.13 g/mol. IUPAC name: 5-fluoro-1-benzofuran-7-carboxylic acid. InChIKey: WSJRATHUSPTLAI-UHFFFAOYSA-N.
| Molecular formula | C9H5FO3 |
|---|---|
| Molecular weight | 180.13 g/mol |
| IUPAC name | 5-fluoro-1-benzofuran-7-carboxylic acid |
| InChIKey | WSJRATHUSPTLAI-UHFFFAOYSA-N |
| SMILES | C1=COC2=C(C=C(C=C21)F)C(=O)O |
Computed by PubChem (NCBI)