Products 1388045-80-4
CAS 1388045-80-4 is the registry number for 5-(3-Bromo-2-chlorophenyl)-1,3,4-thiadiazol-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(3-bromo-2-chlorophenyl)-1,3,4-thiadiazol-2-amine (CAS 1388045-80-4) is a chemical compound with the molecular formula C8H5BrClN3S and a molecular weight of 290.57 g/mol. IUPAC name: 5-(3-bromo-2-chlorophenyl)-1,3,4-thiadiazol-2-amine. InChIKey: NRYCHZDBDZVCOX-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClN3S |
|---|---|
| Molecular weight | 290.57 g/mol |
| IUPAC name | 5-(3-bromo-2-chlorophenyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | NRYCHZDBDZVCOX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)Cl)C2=NN=C(S2)N |
Computed by PubChem (NCBI)