Products 352328-88-2
CAS 352328-88-2 appears in our catalog under these names: 6-bromo-7-chloro-2-methylsulfanyl-pyrido[2,3-d]pyrimidine, 97%, 97%, 6-Bromo-7-chloro-2-(methylthio)pyrido[2,3-d]pyrimidine, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 500mg, 1g, 5g, 10g, 25g, 100mg.
6-bromo-7-chloro-2-methylsulfanylpyrido[2,3-d]pyrimidine (CAS 352328-88-2) is a chemical compound with the molecular formula C8H5BrClN3S and a molecular weight of 290.57 g/mol. IUPAC name: 6-bromo-7-chloro-2-methylsulfanylpyrido[2,3-d]pyrimidine. InChIKey: DNYVNIZXYMXNJS-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClN3S |
|---|---|
| Molecular weight | 290.57 g/mol |
| IUPAC name | 6-bromo-7-chloro-2-methylsulfanylpyrido[2,3-d]pyrimidine |
| InChIKey | DNYVNIZXYMXNJS-UHFFFAOYSA-N |
| SMILES | CSC1=NC2=NC(=C(C=C2C=N1)Br)Cl |
Computed by PubChem (NCBI)