CAS 1388128-13-9 is the registry number for (S)-1-(3-Fluorophenyl)-2,2-dimethylpropan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-(3-fluorophenyl)-2,2-dimethylpropan-1-amine (CAS 1388128-13-9) is a chemical compound with the molecular formula C11H16FN and a molecular weight of 181.25 g/mol. IUPAC name: (1S)-1-(3-fluorophenyl)-2,2-dimethylpropan-1-amine. InChIKey: ONHZOAAJDYSRRQ-SNVBAGLBSA-N.
| Molecular formula | C11H16FN |
|---|---|
| Molecular weight | 181.25 g/mol |
| IUPAC name | (1S)-1-(3-fluorophenyl)-2,2-dimethylpropan-1-amine |
| InChIKey | ONHZOAAJDYSRRQ-SNVBAGLBSA-N |
| SMILES | CC(C)(C)[C@@H](C1=CC(=CC=C1)F)N |
Computed by PubChem (NCBI)