CAS 138871-01-9 is the registry number for 1,2-Difluoro-3-trimethylsilylbenzene, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
(2,3-difluorophenyl)-trimethylsilane (CAS 138871-01-9) is a chemical compound with the molecular formula C9H12F2Si and a molecular weight of 186.27 g/mol. IUPAC name: (2,3-difluorophenyl)-trimethylsilane. InChIKey: KKRXYQBIDGSYLL-UHFFFAOYSA-N.
| Molecular formula | C9H12F2Si |
|---|---|
| Molecular weight | 186.27 g/mol |
| IUPAC name | (2,3-difluorophenyl)-trimethylsilane |
| InChIKey | KKRXYQBIDGSYLL-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=CC=CC(=C1F)F |
Computed by PubChem (NCBI)