CAS 182193-04-0 appears in our catalog under these names: (3,4-difluorophenyl)trimethylsilane, 95%, 95%, 1-(Trimethylsilyl)-3,4-difluorobenzene, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(3,4-difluorophenyl)-trimethylsilane (CAS 182193-04-0) is a chemical compound with the molecular formula C9H12F2Si and a molecular weight of 186.27 g/mol. IUPAC name: (3,4-difluorophenyl)-trimethylsilane. InChIKey: TVUOAIQGAFOTAV-UHFFFAOYSA-N.
| Molecular formula | C9H12F2Si |
|---|---|
| Molecular weight | 186.27 g/mol |
| IUPAC name | (3,4-difluorophenyl)-trimethylsilane |
| InChIKey | TVUOAIQGAFOTAV-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=CC(=C(C=C1)F)F |
Computed by PubChem (NCBI)