Products 1388714-10-0
CAS 1388714-10-0 is the registry number for 2,3,3-Trimethyl-1-(3-phenylpropyl)-3H-indol-1-ium bromide, 98%. Offered by: Fluorochem. Available pack sizes: 1g.
2,3,3-trimethyl-1-(3-phenylpropyl)indol-1-ium bromide (CAS 1388714-10-0) is a chemical compound with the molecular formula C20H24BrN and a molecular weight of 358.3 g/mol. IUPAC name: 2,3,3-trimethyl-1-(3-phenylpropyl)indol-1-ium bromide. InChIKey: KHLASOOVKCCGHU-UHFFFAOYSA-M.
| Molecular formula | C20H24BrN |
|---|---|
| Molecular weight | 358.3 g/mol |
| IUPAC name | 2,3,3-trimethyl-1-(3-phenylpropyl)indol-1-ium bromide |
| InChIKey | KHLASOOVKCCGHU-UHFFFAOYSA-M |
| SMILES | CC1=[N+](C2=CC=CC=C2C1(C)C)CCCC3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)