Products 86727-71-1
CAS 86727-71-1 is the registry number for APTAB. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-anthracen-9-ylpropyl(trimethyl)azanium bromide (CAS 86727-71-1) is a chemical compound with the molecular formula C20H24BrN and a molecular weight of 358.3 g/mol. IUPAC name: 3-anthracen-9-ylpropyl(trimethyl)azanium bromide. InChIKey: QTMSFTSLWQZCOC-UHFFFAOYSA-M.
| Molecular formula | C20H24BrN |
|---|---|
| Molecular weight | 358.3 g/mol |
| IUPAC name | 3-anthracen-9-ylpropyl(trimethyl)azanium bromide |
| InChIKey | QTMSFTSLWQZCOC-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)CCCC1=C2C=CC=CC2=CC3=CC=CC=C31.[Br-] |
Computed by PubChem (NCBI)