Products 138877-09-5
CAS 138877-09-5 appears in our catalog under these names: Ramipril Impurity 2 HCl ((R,R,R)-2-Azabicyclo(3.3.0)octane-3-Carboxylic Acid Benzyl Ester HCl), (R,R,R)-2-Azabicyclo(3.3.0)octane-3-carboxylic Acid Benzyl Ester Hydrochloride Salt, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
Benzyl (2R,3aR,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole-2-carboxylate;hydrochloride (CAS 138877-09-5) is a chemical compound with the molecular formula C15H20ClNO2 and a molecular weight of 281.78 g/mol. IUPAC name: benzyl (2R,3aR,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole-2-carboxylate;hydrochloride. InChIKey: HLXCXOQXUDRJLF-MBLYYGPHSA-N.
| Molecular formula | C15H20ClNO2 |
|---|---|
| Molecular weight | 281.78 g/mol |
| IUPAC name | benzyl (2R,3aR,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole-2-carboxylate;hydrochloride |
| InChIKey | HLXCXOQXUDRJLF-MBLYYGPHSA-N |
| SMILES | C1C[C@@H]2C[C@@H](N[C@@H]2C1)C(=O)OCC3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)