CAS 93779-29-4 is the registry number for Benzyl octahydrocyclopenta[b]pyrrole-2-carboxylate hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Benzyl (2S,6aS)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole-2-carboxylate;hydrochloride (CAS 93779-29-4) is a chemical compound with the molecular formula C15H20ClNO2 and a molecular weight of 281.78 g/mol. IUPAC name: benzyl (2S,6aS)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole-2-carboxylate;hydrochloride. InChIKey: HLXCXOQXUDRJLF-JJARTYCRSA-N.
| Molecular formula | C15H20ClNO2 |
|---|---|
| Molecular weight | 281.78 g/mol |
| IUPAC name | benzyl (2S,6aS)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole-2-carboxylate;hydrochloride |
| InChIKey | HLXCXOQXUDRJLF-JJARTYCRSA-N |
| SMILES | C1C[C@H]2C(C1)C[C@H](N2)C(=O)OCC3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)