Products 1389264-36-1

CAS 1389264-36-1 is the registry number for Methyl 3-azabicyclo(3.1.1)heptane-6-carboxylate hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g, 5g.

Methyl 3-azabicyclo[3.1.1]heptane-6-carboxylate;hydrochloride (CAS 1389264-36-1) is a chemical compound with the molecular formula C8H14ClNO2 and a molecular weight of 191.65 g/mol. IUPAC name: methyl 3-azabicyclo[3.1.1]heptane-6-carboxylate;hydrochloride. InChIKey: XIISKEZBOHDVDM-UHFFFAOYSA-N.

Identity
Molecular formulaC8H14ClNO2
Molecular weight191.65 g/mol
IUPAC namemethyl 3-azabicyclo[3.1.1]heptane-6-carboxylate;hydrochloride
InChIKeyXIISKEZBOHDVDM-UHFFFAOYSA-N
SMILESCOC(=O)C1C2CC1CNC2.Cl

Computed by PubChem (NCBI)