CAS 1389375-52-3 is the registry number for (S)-1-(3,4-Dimethoxyphenyl)-2,2-dimethylpropan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-(3,4-dimethoxyphenyl)-2,2-dimethylpropan-1-amine (CAS 1389375-52-3) is a chemical compound with the molecular formula C13H21NO2 and a molecular weight of 223.31 g/mol. IUPAC name: (1S)-1-(3,4-dimethoxyphenyl)-2,2-dimethylpropan-1-amine. InChIKey: IALPTLGFNLENAL-GFCCVEGCSA-N.
| Molecular formula | C13H21NO2 |
|---|---|
| Molecular weight | 223.31 g/mol |
| IUPAC name | (1S)-1-(3,4-dimethoxyphenyl)-2,2-dimethylpropan-1-amine |
| InChIKey | IALPTLGFNLENAL-GFCCVEGCSA-N |
| SMILES | CC(C)(C)[C@@H](C1=CC(=C(C=C1)OC)OC)N |
Computed by PubChem (NCBI)