Products 1389395-07-6
CAS 1389395-07-6 is the registry number for Des-(3-Methyl-2-ene) 3-Oxo Juvenile Hormone I. Offered by: TRC. Available pack sizes: 100mg.
Methyl (E)-7-ethyl-9-[(2R,3S)-3-ethyl-3-methyloxiran-2-yl]-3-oxonon-6-enoate (CAS 1389395-07-6) is a chemical compound with the molecular formula C17H28O4 and a molecular weight of 296.4 g/mol. IUPAC name: methyl (E)-7-ethyl-9-[(2R,3S)-3-ethyl-3-methyloxiran-2-yl]-3-oxonon-6-enoate. InChIKey: ZODIOAITOBURTD-UJEYXKBXSA-N.
| Molecular formula | C17H28O4 |
|---|---|
| Molecular weight | 296.4 g/mol |
| IUPAC name | methyl (E)-7-ethyl-9-[(2R,3S)-3-ethyl-3-methyloxiran-2-yl]-3-oxonon-6-enoate |
| InChIKey | ZODIOAITOBURTD-UJEYXKBXSA-N |
| SMILES | CC/C(=C\CCC(=O)CC(=O)OC)/CC[C@@H]1[C@](O1)(C)CC |
Computed by PubChem (NCBI)