Products 2381196-79-6
CAS 2381196-79-6 appears in our catalog under these names: PEG3–C4–OBn, 2-(2-((6-(Benzyloxy)hexyl)oxy)ethoxy)ethan-1-ol, 98%, 98%, PEG3-C4-OBn, 99.29%, PEG3-C4-OBn, 98%, PEG3-C4-OBn, 95%. Offered by: GLPBio, Chemat, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 500mg, 25mg, 50mg, 100mg, 250mg, 100 mg, 50 mg, 25 mg.
2-[2-(6-phenylmethoxyhexoxy)ethoxy]ethanol (CAS 2381196-79-6) is a chemical compound with the molecular formula C17H28O4 and a molecular weight of 296.4 g/mol. IUPAC name: 2-[2-(6-phenylmethoxyhexoxy)ethoxy]ethanol. InChIKey: BVCUBCXUEWSFBX-UHFFFAOYSA-N.
| Molecular formula | C17H28O4 |
|---|---|
| Molecular weight | 296.4 g/mol |
| IUPAC name | 2-[2-(6-phenylmethoxyhexoxy)ethoxy]ethanol |
| InChIKey | BVCUBCXUEWSFBX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COCCCCCCOCCOCCO |
Computed by PubChem (NCBI)