CAS 1389800-46-7 is the registry number for (S)-1-(3,5-Dibromophenyl)-2,2-dimethylpropan-1-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-(3,5-dibromophenyl)-2,2-dimethylpropan-1-amine (CAS 1389800-46-7) is a chemical compound with the molecular formula C11H15Br2N and a molecular weight of 321.05 g/mol. IUPAC name: (1S)-1-(3,5-dibromophenyl)-2,2-dimethylpropan-1-amine. InChIKey: DTLIEZPPTMGXPX-SNVBAGLBSA-N.
| Molecular formula | C11H15Br2N |
|---|---|
| Molecular weight | 321.05 g/mol |
| IUPAC name | (1S)-1-(3,5-dibromophenyl)-2,2-dimethylpropan-1-amine |
| InChIKey | DTLIEZPPTMGXPX-SNVBAGLBSA-N |
| SMILES | CC(C)(C)[C@@H](C1=CC(=CC(=C1)Br)Br)N |
Computed by PubChem (NCBI)