CAS 1390662-30-2 is the registry number for (R)-1-(3,5-Dibromophenyl)-2,2-dimethylpropan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-1-(3,5-dibromophenyl)-2,2-dimethylpropan-1-amine (CAS 1390662-30-2) is a chemical compound with the molecular formula C11H15Br2N and a molecular weight of 321.05 g/mol. IUPAC name: (1R)-1-(3,5-dibromophenyl)-2,2-dimethylpropan-1-amine. InChIKey: DTLIEZPPTMGXPX-JTQLQIEISA-N.
| Molecular formula | C11H15Br2N |
|---|---|
| Molecular weight | 321.05 g/mol |
| IUPAC name | (1R)-1-(3,5-dibromophenyl)-2,2-dimethylpropan-1-amine |
| InChIKey | DTLIEZPPTMGXPX-JTQLQIEISA-N |
| SMILES | CC(C)(C)[C@H](C1=CC(=CC(=C1)Br)Br)N |
Computed by PubChem (NCBI)