CAS 139-27-5 is the registry number for alfa-Bromo-(m-Benzoyloxy) acetophenone. Offered by: Chemat Brand. Available pack sizes: on request.
[3-(2-bromoacetyl)phenyl] benzoate (CAS 139-27-5) is a chemical compound with the molecular formula C15H11BrO3 and a molecular weight of 319.15 g/mol. IUPAC name: [3-(2-bromoacetyl)phenyl] benzoate. InChIKey: NBQCBERBYQMIFD-UHFFFAOYSA-N.
| Molecular formula | C15H11BrO3 |
|---|---|
| Molecular weight | 319.15 g/mol |
| IUPAC name | [3-(2-bromoacetyl)phenyl] benzoate |
| InChIKey | NBQCBERBYQMIFD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC2=CC=CC(=C2)C(=O)CBr |
Computed by PubChem (NCBI)