CAS 159175-58-3 is the registry number for (7-Bromo-2,3-dihydrobenzo[b][1,4]dioxin-6-yl)(phenyl)methanone, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-phenylmethanone (CAS 159175-58-3) is a chemical compound with the molecular formula C15H11BrO3 and a molecular weight of 319.15 g/mol. IUPAC name: (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-phenylmethanone. InChIKey: FODLURNKDTZRPK-UHFFFAOYSA-N.
| Molecular formula | C15H11BrO3 |
|---|---|
| Molecular weight | 319.15 g/mol |
| IUPAC name | (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-phenylmethanone |
| InChIKey | FODLURNKDTZRPK-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=C(C(=C2)Br)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)