CAS 139-59-3 appears in our catalog under these names: 4-Phenoxyaniline, 4–Phenoxyaniline, 4-Phenoxyaniline, 97% , 4-Phenoxyaniline, >98.0%(GC)(T), 4-Phenoxyaniline, 97%. Offered by: TRC, Dr. Ehrenstorfer, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 10g, 1g, 5g, 250mg, 100g, 500g, 25g, 1000g.
4-phenoxyaniline (CAS 139-59-3) is a chemical compound with the molecular formula C12H11NO and a molecular weight of 185.22 g/mol. IUPAC name: 4-phenoxyaniline. InChIKey: WOYZXEVUWXQVNV-UHFFFAOYSA-N.
| Molecular formula | C12H11NO |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | 4-phenoxyaniline |
| InChIKey | WOYZXEVUWXQVNV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)