CAS 139047-73-7 is the registry number for 6-(3,5-Dimethyl-1H-pyrazol-1-yl)-1,2,4,5-tetrazin-3-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(3,5-dimethylpyrazol-1-yl)-1,2,4,5-tetrazin-3-amine (CAS 139047-73-7) is a chemical compound with the molecular formula C7H9N7 and a molecular weight of 191.19 g/mol. IUPAC name: 6-(3,5-dimethylpyrazol-1-yl)-1,2,4,5-tetrazin-3-amine. InChIKey: JXJYVOAONGQISS-UHFFFAOYSA-N.
| Molecular formula | C7H9N7 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | 6-(3,5-dimethylpyrazol-1-yl)-1,2,4,5-tetrazin-3-amine |
| InChIKey | JXJYVOAONGQISS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2=NN=C(N=N2)N)C |
Computed by PubChem (NCBI)