CAS 17539-50-3 is the registry number for 6-Methylpteridine-2,4,7-triamine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-methylpteridine-2,4,7-triamine (CAS 17539-50-3) is a chemical compound with the molecular formula C7H9N7 and a molecular weight of 191.19 g/mol. IUPAC name: 6-methylpteridine-2,4,7-triamine. InChIKey: KJXYOOARLVHPMZ-UHFFFAOYSA-N.
| Molecular formula | C7H9N7 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | 6-methylpteridine-2,4,7-triamine |
| InChIKey | KJXYOOARLVHPMZ-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C2C(=N1)C(=NC(=N2)N)N)N |
Computed by PubChem (NCBI)