CAS 1390644-37-7 is the registry number for (R)-5-Hydroxymethyl Tolterodine Methacrylate. Offered by: TRC. Available pack sizes: 10mg.
[2-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(hydroxymethyl)phenyl] 2-methylprop-2-enoate (CAS 1390644-37-7) is a chemical compound with the molecular formula C26H35NO3 and a molecular weight of 409.6 g/mol. IUPAC name: [2-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(hydroxymethyl)phenyl] 2-methylprop-2-enoate. InChIKey: LOCFHEXUJQYDFL-HSZRJFAPSA-N.
| Molecular formula | C26H35NO3 |
|---|---|
| Molecular weight | 409.6 g/mol |
| IUPAC name | [2-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(hydroxymethyl)phenyl] 2-methylprop-2-enoate |
| InChIKey | LOCFHEXUJQYDFL-HSZRJFAPSA-N |
| SMILES | CC(C)N(CC[C@H](C1=CC=CC=C1)C2=C(C=CC(=C2)CO)OC(=O)C(=C)C)C(C)C |
Computed by PubChem (NCBI)