CAS 1435768-96-9 appears in our catalog under these names: Fesoterodine Impurity 9, Fesoterodine Impurity 7, 2-Methyl-propanoic Acid 2-((1R)-3-(Bis(1-methylethyl)amino)-1-phenylpropyl)-4-formylphenyl Ester. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
[2-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-formylphenyl] 2-methylpropanoate (CAS 1435768-96-9) is a chemical compound with the molecular formula C26H35NO3 and a molecular weight of 409.6 g/mol. IUPAC name: [2-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-formylphenyl] 2-methylpropanoate. InChIKey: ICOFQCJKJOISKD-HSZRJFAPSA-N.
| Molecular formula | C26H35NO3 |
|---|---|
| Molecular weight | 409.6 g/mol |
| IUPAC name | [2-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-formylphenyl] 2-methylpropanoate |
| InChIKey | ICOFQCJKJOISKD-HSZRJFAPSA-N |
| SMILES | CC(C)C(=O)OC1=C(C=C(C=C1)C=O)[C@H](CCN(C(C)C)C(C)C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)