CAS 1390654-86-0 is the registry number for [(3-Chloro-1-benzothien-2-yl)methyl]amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
(3-chloro-1-benzothiophen-2-yl)methanamine;hydrochloride (CAS 1390654-86-0) is a chemical compound with the molecular formula C9H9Cl2NS and a molecular weight of 234.14 g/mol. IUPAC name: (3-chloro-1-benzothiophen-2-yl)methanamine;hydrochloride. InChIKey: ISQCRQBMNLERKE-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NS |
|---|---|
| Molecular weight | 234.14 g/mol |
| IUPAC name | (3-chloro-1-benzothiophen-2-yl)methanamine;hydrochloride |
| InChIKey | ISQCRQBMNLERKE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(S2)CN)Cl.Cl |
Computed by PubChem (NCBI)