CAS 67189-27-9 is the registry number for 2-(2,4-Dichlorophenyl)thiazolidine, 97%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
2-(2,4-dichlorophenyl)-1,3-thiazolidine (CAS 67189-27-9) is a chemical compound with the molecular formula C9H9Cl2NS and a molecular weight of 234.14 g/mol. IUPAC name: 2-(2,4-dichlorophenyl)-1,3-thiazolidine. InChIKey: ZWZWFCVEHTWKIS-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NS |
|---|---|
| Molecular weight | 234.14 g/mol |
| IUPAC name | 2-(2,4-dichlorophenyl)-1,3-thiazolidine |
| InChIKey | ZWZWFCVEHTWKIS-UHFFFAOYSA-N |
| SMILES | C1CSC(N1)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)