CAS 1390706-66-7 is the registry number for (1R,3S)-3-(4-Bromophenyl)cyclopentanamine. Offered by: TRC. Available pack sizes: 250mg.
Cis-(1R,3S)-3-(4-bromophenyl)cyclopentan-1-amine (CAS 1390706-66-7) is a chemical compound with the molecular formula C11H14BrN and a molecular weight of 240.14 g/mol. IUPAC name: cis-(1R,3S)-3-(4-bromophenyl)cyclopentan-1-amine. InChIKey: RZPPTYZARIWQCK-GXSJLCMTSA-N.
| Molecular formula | C11H14BrN |
|---|---|
| Molecular weight | 240.14 g/mol |
| IUPAC name | cis-(1R,3S)-3-(4-bromophenyl)cyclopentan-1-amine |
| InChIKey | RZPPTYZARIWQCK-GXSJLCMTSA-N |
| SMILES | C1C[C@H](C[C@H]1C2=CC=C(C=C2)Br)N |
Computed by PubChem (NCBI)