CAS 158326-77-3 appears in our catalog under these names: 7-Bromo-4,4-dimethyl-2,3-dihydro-1H-quinoline, 95%, 7–bromo–4,4–dimethyl–2,3–dihydro–1H–quinoline, 7-bromo-4,4-dimethyl-1,2,3,4-tetrahydroquinoline. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 10g, 5g, 1g, 50mg, 0,5g.
7-bromo-4,4-dimethyl-2,3-dihydro-1H-quinoline (CAS 158326-77-3) is a chemical compound with the molecular formula C11H14BrN and a molecular weight of 240.14 g/mol. IUPAC name: 7-bromo-4,4-dimethyl-2,3-dihydro-1H-quinoline. InChIKey: LHPIITJPRRZXEX-UHFFFAOYSA-N.
| Molecular formula | C11H14BrN |
|---|---|
| Molecular weight | 240.14 g/mol |
| IUPAC name | 7-bromo-4,4-dimethyl-2,3-dihydro-1H-quinoline |
| InChIKey | LHPIITJPRRZXEX-UHFFFAOYSA-N |
| SMILES | CC1(CCNC2=C1C=CC(=C2)Br)C |
Computed by PubChem (NCBI)