CAS 1391052-82-6 appears in our catalog under these names: 5-Oxo Atorvastatin, 5-Oxo Atorvastatin, >95% (HPLC). Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 10mg, 1mg, 2mg, 5mg.
(3R)-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-3-hydroxy-5-oxoheptanoic acid (CAS 1391052-82-6) is a chemical compound with the molecular formula C33H33FN2O5 and a molecular weight of 556.6 g/mol. IUPAC name: (3R)-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-3-hydroxy-5-oxoheptanoic acid. InChIKey: HIWOZSQQGYAAGY-HHHXNRCGSA-N.
| Molecular formula | C33H33FN2O5 |
|---|---|
| Molecular weight | 556.6 g/mol |
| IUPAC name | (3R)-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-3-hydroxy-5-oxoheptanoic acid |
| InChIKey | HIWOZSQQGYAAGY-HHHXNRCGSA-N |
| SMILES | CC(C)C1=C(C(=C(N1CCC(=O)C[C@H](CC(=O)O)O)C2=CC=C(C=C2)F)C3=CC=CC=C3)C(=O)NC4=CC=CC=C4 |
Computed by PubChem (NCBI)