CAS 887196-30-7 appears in our catalog under these names: 3-Oxo Atorvastatin, Atorvastatin Calcium EP Impurity O, 3–Oxo Atorvastatin. Offered by: Chemat Brand, GLPBio, MedChemExpress. Available pack sizes: on request, 1mg, Get quote.
(5R)-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-5-hydroxy-3-oxoheptanoic acid (CAS 887196-30-7) is a chemical compound with the molecular formula C33H33FN2O5 and a molecular weight of 556.6 g/mol. IUPAC name: (5R)-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-5-hydroxy-3-oxoheptanoic acid. InChIKey: JVFCMPKBFPIOON-AREMUKBSSA-N.
| Molecular formula | C33H33FN2O5 |
|---|---|
| Molecular weight | 556.6 g/mol |
| IUPAC name | (5R)-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-5-hydroxy-3-oxoheptanoic acid |
| InChIKey | JVFCMPKBFPIOON-AREMUKBSSA-N |
| SMILES | CC(C)C1=C(C(=C(N1CC[C@H](CC(=O)CC(=O)O)O)C2=CC=C(C=C2)F)C3=CC=CC=C3)C(=O)NC4=CC=CC=C4 |
Computed by PubChem (NCBI)