CAS 1391052-83-7 is the registry number for 2',3'-Dihydro-7-methoxy-spiro(isobenzofuran-1(3H),1'-(1H)phenalen)-3-one. Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
7-methoxyspiro[1,2-dihydrophenalene-3,3'-2-benzofuran]-1'-one (CAS 1391052-83-7) is a chemical compound with the molecular formula C21H16O3 and a molecular weight of 316.3 g/mol. IUPAC name: 7-methoxyspiro[1,2-dihydrophenalene-3,3'-2-benzofuran]-1'-one. InChIKey: OPICFBPAUCLDLZ-UHFFFAOYSA-N.
| Molecular formula | C21H16O3 |
|---|---|
| Molecular weight | 316.3 g/mol |
| IUPAC name | 7-methoxyspiro[1,2-dihydrophenalene-3,3'-2-benzofuran]-1'-one |
| InChIKey | OPICFBPAUCLDLZ-UHFFFAOYSA-N |
| SMILES | COC1=C2C=CC=C3C2=C(CCC34C5=CC=CC=C5C(=O)O4)C=C1 |
Computed by PubChem (NCBI)