CAS 66240-12-8 is the registry number for 3-Methoxybenz(a)anthracen-12-ol 12-Acetate. Offered by: TRC. Available pack sizes: 100mg, 250mg, 25mg.
(3-methoxybenzo[a]anthracen-12-yl) acetate (CAS 66240-12-8) is a chemical compound with the molecular formula C21H16O3 and a molecular weight of 316.3 g/mol. IUPAC name: (3-methoxybenzo[a]anthracen-12-yl) acetate. InChIKey: JWCUXWWNYJFBSJ-UHFFFAOYSA-N.
| Molecular formula | C21H16O3 |
|---|---|
| Molecular weight | 316.3 g/mol |
| IUPAC name | (3-methoxybenzo[a]anthracen-12-yl) acetate |
| InChIKey | JWCUXWWNYJFBSJ-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C2C(=CC3=CC=CC=C31)C=CC4=C2C=CC(=C4)OC |
Computed by PubChem (NCBI)