CAS 1391053-21-6 appears in our catalog under these names: Phenothiazine Impurity 2, N-(2-Propenyl)-2-methylsulfonyl-10H-phenothiazine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 2,5mg, 25mg.
2-methylsulfonyl-10-prop-2-enylphenothiazine (CAS 1391053-21-6) is a chemical compound with the molecular formula C16H15NO2S2 and a molecular weight of 317.4 g/mol. IUPAC name: 2-methylsulfonyl-10-prop-2-enylphenothiazine. InChIKey: KLXNEAXMKJWVOU-UHFFFAOYSA-N.
| Molecular formula | C16H15NO2S2 |
|---|---|
| Molecular weight | 317.4 g/mol |
| IUPAC name | 2-methylsulfonyl-10-prop-2-enylphenothiazine |
| InChIKey | KLXNEAXMKJWVOU-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC2=C(C=C1)SC3=CC=CC=C3N2CC=C |
Computed by PubChem (NCBI)