CAS 1794940-43-4 appears in our catalog under these names: Phenothiazine Impurity 2-d5, N-(2-Propenyl)-2-methylsulfonyl-10H-phenothiazine-d5. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 2,5mg, 25mg.
2-methylsulfonyl-10-(1,1,2,3,3-pentadeuterioprop-2-enyl)phenothiazine (CAS 1794940-43-4) is a chemical compound with the molecular formula C16H15NO2S2 and a molecular weight of 322.5 g/mol. IUPAC name: 2-methylsulfonyl-10-(1,1,2,3,3-pentadeuterioprop-2-enyl)phenothiazine. InChIKey: KLXNEAXMKJWVOU-IZHVEIGHSA-N.
| Molecular formula | C16H15NO2S2 |
|---|---|
| Molecular weight | 322.5 g/mol |
| IUPAC name | 2-methylsulfonyl-10-(1,1,2,3,3-pentadeuterioprop-2-enyl)phenothiazine |
| InChIKey | KLXNEAXMKJWVOU-IZHVEIGHSA-N |
| SMILES | [2H]C(=C([2H])C([2H])([2H])N1C2=CC=CC=C2SC3=C1C=C(C=C3)S(=O)(=O)C)[2H] |
Computed by PubChem (NCBI)