Products 1391053-28-3

CAS 1391053-28-3 is the registry number for rac 5-Carboxy Desisopropyl Tolterodine Methyl Ester. Offered by: TRC. Available pack sizes: 50mg, 5mg.

Structural formula: {0} (CAS {1})

Methyl 4-hydroxy-3-[1-phenyl-3-(propan-2-ylamino)propyl]benzoate (CAS 1391053-28-3) is a chemical compound with the molecular formula C20H25NO3 and a molecular weight of 327.4 g/mol. IUPAC name: methyl 4-hydroxy-3-[1-phenyl-3-(propan-2-ylamino)propyl]benzoate. InChIKey: BXVUSHZWMYUKKK-UHFFFAOYSA-N.

Identity
Molecular formulaC20H25NO3
Molecular weight327.4 g/mol
IUPAC namemethyl 4-hydroxy-3-[1-phenyl-3-(propan-2-ylamino)propyl]benzoate
InChIKeyBXVUSHZWMYUKKK-UHFFFAOYSA-N
SMILESCC(C)NCCC(C1=CC=CC=C1)C2=C(C=CC(=C2)C(=O)OC)O

Computed by PubChem (NCBI)