Products 1794780-63-4
CAS 1794780-63-4 is the registry number for rac 5-Carboxy Desisopropyl Tolterodine-d7 Methyl Ester. Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
Methyl 3-[3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-1-phenylpropyl]-4-hydroxybenzoate (CAS 1794780-63-4) is a chemical compound with the molecular formula C20H25NO3 and a molecular weight of 334.5 g/mol. IUPAC name: methyl 3-[3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-1-phenylpropyl]-4-hydroxybenzoate. InChIKey: BXVUSHZWMYUKKK-HSNISVEUSA-N.
| Molecular formula | C20H25NO3 |
|---|---|
| Molecular weight | 334.5 g/mol |
| IUPAC name | methyl 3-[3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-1-phenylpropyl]-4-hydroxybenzoate |
| InChIKey | BXVUSHZWMYUKKK-HSNISVEUSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NCCC(C1=CC=CC=C1)C2=C(C=CC(=C2)C(=O)OC)O |
Computed by PubChem (NCBI)