CAS 1391053-74-9 is the registry number for 3-Des(2-(Dimethylamino)ethyl)-3-(1-methyl-1-(methylamino)ethyl) Almotriptan. Offered by: TRC. Available pack sizes: 5mg.
N-methyl-2-[5-(pyrrolidin-1-ylsulfonylmethyl)-1H-indol-3-yl]propan-2-amine (CAS 1391053-74-9) is a chemical compound with the molecular formula C17H25N3O2S and a molecular weight of 335.5 g/mol. IUPAC name: N-methyl-2-[5-(pyrrolidin-1-ylsulfonylmethyl)-1H-indol-3-yl]propan-2-amine. InChIKey: JTKLUEVZWJJXNS-UHFFFAOYSA-N.
| Molecular formula | C17H25N3O2S |
|---|---|
| Molecular weight | 335.5 g/mol |
| IUPAC name | N-methyl-2-[5-(pyrrolidin-1-ylsulfonylmethyl)-1H-indol-3-yl]propan-2-amine |
| InChIKey | JTKLUEVZWJJXNS-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CNC2=C1C=C(C=C2)CS(=O)(=O)N3CCCC3)NC |
Computed by PubChem (NCBI)