CAS 54230-60-3 appears in our catalog under these names: 1–(2,4,6–Triisopropylphenylsulfonyl)–1,2,4–triazole, 1-(2,4,6-Triisopropylbenzenesulfonyl)-1,2,4-triazole, 98%, 98%, 1-((2,4,6-Triisopropylphenyl)sulfonyl)-1H-1,2,4-triazole, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g.
1-[2,4,6-tri(propan-2-yl)phenyl]sulfonyl-1,2,4-triazole (CAS 54230-60-3) is a chemical compound with the molecular formula C17H25N3O2S and a molecular weight of 335.5 g/mol. IUPAC name: 1-[2,4,6-tri(propan-2-yl)phenyl]sulfonyl-1,2,4-triazole. InChIKey: BKJMMUUBRUWPPQ-UHFFFAOYSA-N.
| Molecular formula | C17H25N3O2S |
|---|---|
| Molecular weight | 335.5 g/mol |
| IUPAC name | 1-[2,4,6-tri(propan-2-yl)phenyl]sulfonyl-1,2,4-triazole |
| InChIKey | BKJMMUUBRUWPPQ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C(=C1)C(C)C)S(=O)(=O)N2C=NC=N2)C(C)C |
Computed by PubChem (NCBI)